For research use only. Not for therapeutic Use.
4-Aminobenzaldehyde（Cat No.:I044733）is an aromatic compound featuring both an amino group (–NH₂) and an aldehyde group (–CHO) positioned para to each other on a benzene ring. This dual functionality makes it a valuable intermediate in organic synthesis, particularly in the production of Schiff bases, dyes, and pharmaceuticals. The amino group can undergo acylation or diazotization, while the aldehyde group is reactive in condensation reactions, such as the formation of imines. 4-Aminobenzaldehyde is also used in the synthesis of heterocyclic compounds and serves as a building block in medicinal and material chemistry.
| CAS Number | 556-18-3 |
| Synonyms | 4-aminobenzaldehyde |
| Molecular Formula | C7H7NO |
| Purity | ≥95% |
| IUPAC Name | 4-aminobenzaldehyde |
| InChI | InChI=1S/C7H7NO/c8-7-3-1-6(5-9)2-4-7/h1-5H,8H2 |
| InChIKey | VATYWCRQDJIRAI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
