For research use only. Not for therapeutic Use.
4-Amino-N, N-dipropylbenzamide(Cat No.:L006838), is an organic compound consisting of a benzamide core with an amino group and two propyl substituents. This compound has applications in medicinal chemistry and drug design, often serving as a building block in the synthesis of biologically active compounds and pharmaceuticals. Researchers utilize its unique structure for the development of novel drugs targeting specific biological pathways.
Catalog Number | L006838 |
CAS Number | 79868-19-2 |
Molecular Formula | C13H20N2O |
Purity | ≥95% |
IUPAC Name | 4-amino-N,N-dipropylbenzamide |
InChI | InChI=1S/C13H20N2O/c1-3-9-15(10-4-2)13(16)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3 |
InChIKey | YZZJRTKRDSVWQU-UHFFFAOYSA-N |
SMILES | CCCN(CCC)C(=O)C1=CC=C(C=C1)N |