For research use only. Not for therapeutic Use.
4-Amino-L-phenylalanine dihydrochloride(CAT: L000392) is a compound with significant relevance in pharmaceutical and organic chemistry. This chemical serves as a valuable intermediate for the synthesis of various pharmaceuticals, particularly in the field of medicinal chemistry. It contains an amino group and is an important component in the development of therapeutic agents. In pharmaceutical chemistry, it plays a pivotal role in creating molecules targeting specific biological receptors or enzymes.
| CAS Number | 139879-21-3 |
| Molecular Formula | C9H14Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-3-(4-aminophenyl)propanoic acid;dihydrochloride |
| InChI | InChI=1S/C9H12N2O2.2ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;;/h1-4,8H,5,10-11H2,(H,12,13);2*1H/t8-;;/m0../s1 |
| InChIKey | WHIVGCGPZWTJOQ-JZGIKJSDSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |