For research use only. Not for therapeutic Use.
4-Amino-5-phenyl-4H-1,2,4-triazole-3-thiol(Cat No.:M247311)is a heterocyclic compound with significant potential in medicinal chemistry, particularly in developing pharmaceuticals with antimicrobial, antifungal, and anti-inflammatory properties. The triazole ring, combined with the thiol and amino groups, offers versatile reactivity, making it a valuable intermediate in synthesizing biologically active molecules. The phenyl group enhances the compound’s stability and potential interaction with biological targets. This compound is often used in designing new drug candidates, exploring its role in various therapeutic applications, and studying its biological activities.
| CAS Number | 22706-11-2 |
| Molecular Formula | C8H8N4S |
| Purity | ≥95% |
| IUPAC Name | 4-amino-3-phenyl-1H-1,2,4-triazole-5-thione |
| InChI | InChI=1S/C8H8N4S/c9-12-7(10-11-8(12)13)6-4-2-1-3-5-6/h1-5H,9H2,(H,11,13) |
| InChIKey | OKNHZPGPLNUEPC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=S)N2N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |