Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 4-amino-5-chloro-2-methoxy-N-(piperidin-4-ylmethyl)benzamide
For research use only. Not for therapeutic Use.
4-amino-5-chloro-2-methoxy-N-(piperidin-4-ylmethyl)benzamide (Cat No.:L025342) is an organic compound with a benzamide core bearing an amino group at position 4, a chlorine atom at position 5, and a methoxy group at position 2. Additionally, a piperidine ring is attached to the benzamide nitrogen. This compound’s unique structure suggests potential applications in pharmaceutical research, where the piperidine and benzamide moieties may contribute to bioactivity. The chlorine and methoxy groups offer opportunities for chemical modifications, making them valuable in medicinal chemistry for designing bioactive molecules and exploring structure-activity relationships.
CAS Number | 220032-26-8 |
Molecular Formula | C14H20ClN3O2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 4-amino-5-chloro-2-methoxy-N-(piperidin-4-ylmethyl)benzamide |
InChI | InChI=1S/C14H20ClN3O2/c1-20-13-7-12(16)11(15)6-10(13)14(19)18-8-9-2-4-17-5-3-9/h6-7,9,17H,2-5,8,16H2,1H3,(H,18,19) |
InChIKey | YBUGDJUVZUNIRB-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1C(=O)NCC2CCNCC2)Cl)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |