For research use only. Not for therapeutic Use.
4-Amino-3,5-dichloro-2-methylpyridine(CAT: M040871) is a high-purity halogenated pyridine derivative featuring an amino group at the 4-position, two chlorine atoms at the 3- and 5-positions, and a methyl substituent at the 2-position. This versatile molecule serves as a critical intermediate in pharmaceutical research and agrochemical development, particularly for synthesizing bioactive compounds such as enzyme inhibitors, antimicrobials, and herbicides. Its combination of halogenation and amino functionality allows for targeted derivatization and cross-coupling reactions, enabling complex molecular synthesis. 4-Amino-3,5-dichloro-2-methylpyridine offers excellent stability and reactivity, making it ideal for advanced medicinal chemistry and precision-driven synthetic applications.
CAS Number | 195045-26-2 |
Synonyms | 4-AMINO-3,5-DICHLORO-2-METHYLPYRIDINE |
Molecular Formula | C6H6Cl2N2 |
Purity | ≥95% |
Storage | 4°C |
IUPAC Name | 3,5-dichloro-2-methylpyridin-4-amine |
InChI | InChI=1S/C6H6Cl2N2/c1-3-5(8)6(9)4(7)2-10-3/h2H,1H3,(H2,9,10) |
InChIKey | FXWROTFWPALSQJ-UHFFFAOYSA-N |
SMILES | CC1=NC=C(C(=C1Cl)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |