For research use only. Not for therapeutic Use.
4-Amino-3-phenylbutyric acid hydrochloride(Cat No.:M071313)is a synthetic amino acid derivative structurally related to γ-aminobutyric acid (GABA), featuring a phenyl-substituted side chain that enhances lipophilicity and bioavailability. As a GABA analogue, it is of interest in neurological and pharmacological research for its potential to modulate synaptic activity, exhibit anxiolytic properties, or cross the blood-brain barrier more effectively than GABA itself. Supplied as a stable hydrochloride salt, it offers improved solubility in water and compatibility with a range of experimental conditions in CNS-focused studies.
| CAS Number | 1078-21-3 |
| Molecular Formula | C10H13NO2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-amino-3-phenylbutanoic acid |
| InChI | InChI=1S/C10H13NO2/c11-7-9(6-10(12)13)8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13) |
| InChIKey | DAFOCGYVTAOKAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)CN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |