For research use only. Not for therapeutic Use.
4-Amino-2-chloropyridin-3-ol(Cat No.:L033330)is a multifunctional heterocyclic compound used in pharmaceutical research and organic synthesis. Its structure, featuring an amino group at the 4-position, a chlorine atom at the 2-position, and a hydroxyl group at the 3-position of the pyridine ring, provides unique reactivity for creating complex molecules. This compound is particularly valuable in the development of drug candidates, where it can serve as an intermediate for synthesizing biologically active molecules. Its versatility and reactive functional groups make it an essential building block in medicinal chemistry and advanced chemical synthesis.
CAS Number | 1227508-94-2 |
Molecular Formula | C5H5ClN2O |
Purity | ≥95% |
IUPAC Name | 4-amino-2-chloropyridin-3-ol |
InChI | InChI=1S/C5H5ClN2O/c6-5-4(9)3(7)1-2-8-5/h1-2,9H,(H2,7,8) |
InChIKey | RJCSGFKTKREJDU-UHFFFAOYSA-N |
SMILES | C1=CN=C(C(=C1N)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |