For research use only. Not for therapeutic Use.
4-Amino-2-chloro-6,7-dimethoxyquinazoline (Cat No.: R005293) is a substituted quinazoline derivative commonly used as an intermediate in the synthesis of kinase inhibitors, particularly those targeting epidermal growth factor receptors (EGFR). Its structure features a quinazoline core with electron-donating methoxy groups at the 6 and 7 positions, an amino group at position 4, and a reactive chlorine at position 2, enabling selective nucleophilic substitution. This compound plays a significant role in medicinal chemistry for developing anticancer agents and other bioactive molecules targeting intracellular signaling pathways.
CAS Number | 23680-84-4 |
Synonyms | 2-Chloro-6,7-dimethoxy-4-quinazolinamine; USP Doxazosine Related Compound C; |
Molecular Formula | C10H10ClN3O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-chloro-6,7-dimethoxyquinazolin-4-amine |
InChI | InChI=1S/C10H10ClN3O2/c1-15-7-3-5-6(4-8(7)16-2)13-10(11)14-9(5)12/h3-4H,1-2H3,(H2,12,13,14) |
InChIKey | HWIIAAVGRHKSOJ-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C(=NC(=N2)Cl)N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |