4-Acetyl-2-methylbenzoic acid - CAS 55860-35-0

4-Acetyl-2-methylbenzoic acid (Cat.No:L003435) is a notable chemical compound used in various industrial applications. Its structure combines an acetyl and a methyl group, conferring unique reactivity. This compound serves as a crucial intermediate in the synthesis of pharmaceuticals and specialized materials. Its versatile nature and widespread applications underscore its significance in organic synthesis, making it an important component in the realm of chemical research and development.

Catalog Number: L003435

CAS Number: 55860-35-0

Molecular Formula: C10H10O3

Molecular Weight:178.18

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C10H10O3
Molecular Weight178.18
Purity≥95%

Computed Descriptor

IUPAC Name4-acetyl-2-methylbenzoic acid
InChIInChI=1S/C10H10O3/c1-6-5-8(7(2)11)3-4-9(6)10(12)13/h3-5H,1-2H3,(H,12,13)
InChIKeyQGXDUDDPMXVLOO-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(=O)C)C(=O)O