For research use only. Not for therapeutic Use.
4-Acetyl-2-chlorobenzoic acid(Cat No.:L028629)is an aromatic compound used in organic synthesis and pharmaceutical research. The molecule features a benzoic acid core with an acetyl group at the 4-position and a chlorine atom at the 2-position, providing unique reactivity for various chemical transformations. This compound is valuable as an intermediate in the synthesis of complex molecules, including potential drug candidates and fine chemicals. Its functional groups allow for versatile modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
CAS Number | 115382-35-9 |
Molecular Formula | C9H7ClO3 |
Purity | ≥95% |
IUPAC Name | 4-acetyl-2-chlorobenzoic acid |
InChI | InChI=1S/C9H7ClO3/c1-5(11)6-2-3-7(9(12)13)8(10)4-6/h2-4H,1H3,(H,12,13) |
InChIKey | KASJLCWKGSURCV-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(C=C1)C(=O)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |