For research use only. Not for therapeutic Use.
4-Acetamidothiophenol (Cat.No:M047050) is a chemical compound used in organic synthesis and as a reagent in biochemical research. Its structure includes an acetamido group and a thiol (sulfhydryl) group attached to a thiophenol ring. This compound serves as a building block in various chemical reactions and is employed in diverse laboratory applications.
CAS Number | 1126-81-4 |
Molecular Formula | C8H9NOS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-(4-sulfanylphenyl)acetamide |
InChI | InChI=1S/C8H9NOS/c1-6(10)9-7-2-4-8(11)5-3-7/h2-5,11H,1H3,(H,9,10) |
InChIKey | AYEQJLOHMLYKAV-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=CC=C(C=C1)S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |