For research use only. Not for therapeutic Use.
(4-(9H-Carbazol-9-yl)phenyl)methanol(CAT: L000269) is a notable chemical compound with relevance in both material chemistry and the field of organic chemistry. This compound acts as a versatile building block for the synthesis of organic materials with unique electronic properties, owing to the carbazole moiety. In material chemistry, it is used to create organic semiconductors and electroluminescent materials, making it essential for the development of organic electronic devices.
CAS Number | 71935-22-3 |
Molecular Formula | C19H15NO |
Purity | ≥95% |
IUPAC Name | (4-carbazol-9-ylphenyl)methanol |
InChI | InChI=1S/C19H15NO/c21-13-14-9-11-15(12-10-14)20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,21H,13H2 |
InChIKey | KHXHSSGYKUMCBJ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |