4-(6-Methyl-1,2,4,5-tetrazin-3-yl)benzoic acid (CAT: L000307) is a significant compound in the field of pharmaceutical and organic chemistry. This molecule acts as a crucial building block in the synthesis of various pharmaceutical agents and organic compounds. Its tetrazinyl moiety imparts unique reactivity, making it an essential intermediate for drug development. Researchers leverage its versatility to create potential drug candidates, especially in the context of cancer research, where its distinctive structure finds applications in the development of novel anticancer agents.
Catalog Number | L000307 |
CAS Number | 1345866-66-1 |
Molecular Formula | C10H8N4O2 |
Purity | 95% |
IUPAC Name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)benzoic acid |
InChI | InChI=1S/C10H8N4O2/c1-6-11-13-9(14-12-6)7-2-4-8(5-3-7)10(15)16/h2-5H,1H3,(H,15,16) |
InChIKey | VIRCHPVFFZGAJH-UHFFFAOYSA-N |