For research use only. Not for therapeutic Use.
4-(6-Bromopyridin-2-yl)benzoic acid is an aromatic compound composed of a benzoic acid moiety linked to a 6-bromopyridin-2-yl group. This structure, featuring both a carboxylic acid and a brominated pyridine ring, makes it a versatile intermediate in organic synthesis. It is commonly used in pharmaceutical and material science research, particularly for developing functionalized molecules, such as heterocyclic compounds and coordination complexes. Its structure supports applications in drug discovery, where it contributes to the design of compounds with potential therapeutic activity.
| CAS Number | 928658-23-5 |
| Molecular Formula | C12H8BrNO2 |
| Purity | ≥95% |
| IUPAC Name | 4-(6-bromopyridin-2-yl)benzoic acid |
| InChI | InChI=1S/C12H8BrNO2/c13-11-3-1-2-10(14-11)8-4-6-9(7-5-8)12(15)16/h1-7H,(H,15,16) |
| InChIKey | LJVFAKRRQNUNES-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)C2=CC=C(C=C2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |