For research use only. Not for therapeutic Use.
4-(5-Bromopyrimidin-2-yl)thiomorpholine(CAT: L032123) is a heterocyclic compound featuring a thiomorpholine ring attached to a 5-bromopyrimidine moiety. This versatile molecule is widely utilized in pharmaceutical research as an intermediate in the synthesis of bioactive compounds, particularly in the development of kinase inhibitors and other therapeutic agents. Its unique structure, combining a sulfur-containing heterocycle and a halogenated pyrimidine, offers significant potential for medicinal chemistry applications. With high purity and excellent stability, 4-(5-Bromopyrimidin-2-yl)thiomorpholine provides a reliable foundation for advancing drug discovery and synthetic organic chemistry projects.
CAS Number | 1341761-16-7 |
Molecular Formula | C8H10BrN3S |
Purity | ≥95% |
IUPAC Name | 4-(5-bromopyrimidin-2-yl)thiomorpholine |
InChI | InChI=1S/C8H10BrN3S/c9-7-5-10-8(11-6-7)12-1-3-13-4-2-12/h5-6H,1-4H2 |
InChIKey | REZKNBRYYCJBMD-UHFFFAOYSA-N |
SMILES | C1CSCCN1C2=NC=C(C=N2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |