Home
>
Reference Standards>Heterocyclic Building Blocks> 4-[4-[(5S)-5-Phthalimidomethyl-2-oxo-3-oxazolidinyl]phenyl]-3-morpholinone
For research use only. Not for therapeutic Use.
4-[4-[(5S)-5-Phthalimidomethyl-2-oxo-3-oxazolidinyl]phenyl]-3-morpholinone(Cat No.:R048951)is a complex, chiral heterocyclic compound featuring multiple bioactive moieties. It incorporates a (5S)-oxazolidinone ring bearing a phthalimidomethyl substituent, linked to a para-substituted phenyl ring, which is further connected to a morpholinone unit. This structure combines elements known for their utility in drug discovery, particularly in antibacterial and anticancer research. The oxazolidinone scaffold contributes to stereochemical control and potential protein-binding interactions, while the phthalimide group serves as a protecting or bioisosteric unit. Overall, this multifunctional compound is ideal for SAR studies and medicinal chemistry applications.
CAS Number | 446292-08-6 |
Synonyms | 2-[[(5S)-2-Oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-1H-isoindole-1,3(2H)-dione; |
Molecular Formula | C22H19N3O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[[(5S)-2-oxo-3-[4-(3-oxomorpholin-4-yl)phenyl]-1,3-oxazolidin-5-yl]methyl]isoindole-1,3-dione |
InChI | InChI=1S/C22H19N3O6/c26-19-13-30-10-9-23(19)14-5-7-15(8-6-14)24-11-16(31-22(24)29)12-25-20(27)17-3-1-2-4-18(17)21(25)28/h1-8,16H,9-13H2/t16-/m1/s1 |
InChIKey | KUQNYAUTIWQAKY-MRXNPFEDSA-N |
SMILES | C1COCC(=O)N1C2=CC=C(C=C2)N3C[C@@H](OC3=O)CN4C(=O)C5=CC=CC=C5C4=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |