For research use only. Not for therapeutic Use.
4-[4-(4-Nitrophenyl)-1-piperazinyl]phenol is a piperazine derivative with a nitrophenyl group and a phenolic moiety. This compound is widely used in pharmaceutical research as an intermediate in the synthesis of bioactive molecules, particularly those targeting neurological and psychiatric conditions. Its structure, featuring both a phenolic and nitrophenyl group, allows for versatile chemical modifications, making it useful for developing drugs with potential antipsychotic or antidepressant properties. It plays a key role in medicinal chemistry and drug discovery.
CAS Number | 112559-81-6 |
Molecular Formula | C16H17N3O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-[4-(4-nitrophenyl)piperazin-1-yl]phenol |
InChI | InChI=1S/C16H17N3O3/c20-16-7-5-14(6-8-16)18-11-9-17(10-12-18)13-1-3-15(4-2-13)19(21)22/h1-8,20H,9-12H2 |
InChIKey | BNHYDULILNJFFY-UHFFFAOYSA-N |
SMILES | C1CN(CCN1C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=C(C=C3)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |