For research use only. Not for therapeutic Use.
4-(2-Fluorophenyl)butan-2-one(Cat No.:L007186), is a chemical compound with the molecular formula C10H11FO. It features a butanone backbone—a four-carbon ketone chain—with a fluorophenyl group at the 4th carbon. This compound is significant in organic synthesis and medicinal chemistry research. Its unique structure, combining a ketone and a fluorophenyl moiety, offers versatility in creating compounds with various biological activities, making it valuable for drug discovery and the development of novel chemical entities. Researchers utilize 4-(2-Fluorophenyl)butan-2-one as a key intermediate, contributing to advancements in medicinal chemistry research and the creation of specialized organic molecules for various applications.
CAS Number | 63416-65-9 |
Molecular Formula | C10H11FO |
Purity | ≥95% |
IUPAC Name | 4-(2-fluorophenyl)butan-2-one |
InChI | InChI=1S/C10H11FO/c1-8(12)6-7-9-4-2-3-5-10(9)11/h2-5H,6-7H2,1H3 |
InChIKey | GDRXVYJUCGIYLB-UHFFFAOYSA-N |
SMILES | CC(=O)CCC1=CC=CC=C1F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |