For research use only. Not for therapeutic Use.
4-(2-Aminoethyl)-1-boc-piperidine (Cat.No:R038032) is a chemical compound commonly used as an intermediate in organic synthesis. Its Boc (tert-butyloxycarbonyl) protection group helps manipulate reactivity in peptide and drug development. This compound plays a crucial role in creating complex molecular structures for various applications in the pharmaceutical and chemical industries.
| CAS Number | 146093-46-1 |
| Molecular Formula | C12H24N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | tert-butyl 4-(2-aminoethyl)piperidine-1-carboxylate |
| InChI | InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-8-5-10(4-7-13)6-9-14/h10H,4-9,13H2,1-3H3 |
| InChIKey | LBQDLHPFISVBRU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |