For research use only. Not for therapeutic Use.
4-(2-Amino-1,3-thiazol-4-yl)phenol(CAT: M347106) is a heterocyclic compound containing a phenol group linked to a 2-amino-1,3-thiazole ring. The combination of an amino group on the thiazole and a hydroxyl group on the phenyl ring provides multiple reactive sites, making it valuable in medicinal and synthetic organic chemistry. This compound can serve as a building block in synthesizing biologically active molecules, particularly in drug design, where the thiazole ring is often found in pharmacologically active compounds due to its electron-rich nature and ability to participate in hydrogen bonding. The phenolic hydroxyl group enhances its reactivity and can be further modified through alkylation, acylation, or other derivatization methods. This structure is commonly explored in developing enzyme inhibitors, receptor ligands, and other bioactive compounds due to its versatile chemical functionality.
CAS Number | 57634-55-6 |
Molecular Formula | C9H8N2OS |
Purity | ≥95% |
IUPAC Name | 4-(2-amino-1,3-thiazol-4-yl)phenol |
InChI | InChI=1S/C9H8N2OS/c10-9-11-8(5-13-9)6-1-3-7(12)4-2-6/h1-5,12H,(H2,10,11) |
InChIKey | QGSJYYIRAFRPIT-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CSC(=N2)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |