4-[2-(1H-Imidazol-1-yl)ethoxy]benzaldehyde hydrochloride - CAS 1609409-04-2
4-[2-(1H-Imidazol-1-yl)ethoxy]benzaldehyde hydrochloride(Cat No.:L008529), is a chemical compound characterized by a benzaldehyde core with an imidazolyl group attached via an ethoxy linker, and it exists as the hydrochloride salt. This structure is relevant in organic synthesis and potentially in medicinal chemistry. The presence of the imidazolyl group and the ethoxy linker contributes to the compound’s reactivity and potential pharmacological properties.
Catalog Number: L008529
CAS Number: 1609409-04-2
Molecular Formula: C12H13ClN2O2
Molecular Weight:252.69
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C12H13ClN2O2 |
---|---|
Molecular Weight | 252.69 |
Purity | ≥95% |
Computed Descriptor
IUPAC Name | 4-(2-imidazol-1-ylethoxy)benzaldehyde;hydrochloride |
---|---|
InChI | InChI=1S/C12H12N2O2.ClH/c15-9-11-1-3-12(4-2-11)16-8-7-14-6-5-13-10-14;/h1-6,9-10H,7-8H2;1H |
InChIKey | HOYKXDHAQCEAKB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C=O)OCCN2C=CN=C2.Cl |