For research use only. Not for therapeutic Use.
4-(1,2,2-Triphenylvinyl)benzoic Acid (Cat.No:L004015) is a significant compound in materials science. Its unique structure, featuring a triphenylvinyl group, imparts specialized properties. This compound serves as a valuable precursor in the synthesis of specialized polymers and liquid crystals, with applications in electronic devices.
CAS Number | 197153-87-0 |
Molecular Formula | C27H20O2 |
Purity | ≥95% |
IUPAC Name | 4-(1,2,2-triphenylethenyl)benzoic acid |
InChI | InChI=1S/C27H20O2/c28-27(29)24-18-16-23(17-19-24)26(22-14-8-3-9-15-22)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19H,(H,28,29) |
InChIKey | BYQULXPMSUDNFL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |