For research use only. Not for therapeutic Use.
(3S,4S)-PF‑06459988（Cat No.:I045049）is the less-active S‑enantiomer of PF‑06459988, a third-generation, irreversible small-molecule inhibitor of epidermal growth factor receptor (EGFR). It targets double-mutant EGFR forms—particularly the T790M-containing variants—while sparing wild-type EGFR, thereby enhancing specificity and minimizing off‑target effects. The compound features a minimally reactive electrophilic warhead, reducing nonspecific covalent binding and proteome reactivity. Primarily used in cancer research, (3S,4S)-PF‑06459988 helps study resistance mechanisms in EGFR‑mutant non‑small cell lung cancer and evaluate potential therapeutic strategies.
| CAS Number | 1858291-14-1 |
| Molecular Formula | C19H22ClN7O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[(3S,4S)-3-[[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxymethyl]-4-methoxypyrrolidin-1-yl]prop-2-en-1-one |
| InChI | InChI=1S/C19H22ClN7O3/c1-4-15(28)27-7-11(14(9-27)29-3)10-30-18-16-13(20)6-21-17(16)24-19(25-18)23-12-5-22-26(2)8-12/h4-6,8,11,14H,1,7,9-10H2,2-3H3,(H2,21,23,24,25)/t11-,14+/m0/s1 |
| InChIKey | ODMXWZROLKITMS-SMDDNHRTSA-N |
| SMILES | CN1C=C(C=N1)NC2=NC3=C(C(=CN3)Cl)C(=N2)OC[C@@H]4CN(C[C@H]4OC)C(=O)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
