(3R,3'R)-3,3'-di-tert-Butyl-2,2',3,3'-tetrahydro-4,4'-bibenzo[d][1,3]oxaphosphole - CAS 2214207-73-3
(3R,3’R)-3,3′-di-tert-Butyl-2,2′,3,3′-tetrahydro-4,4′-bibenzo[d][1,3]oxaphosphole (Cat.No:L004074) is a crucial compound in materials science. Its unique structure, featuring a bibenzo oxaphosphole core and tert-butyl substituents, imparts specialized properties. This compound serves as a valuable building block in the synthesis of advanced materials, particularly in optoelectronic applications.
![(3R,3'R)-3,3'-di-tert-Butyl-2,2',3,3'-tetrahydro-4,4'-bibenzo[d][1,3]oxaphosphole](https://www.musechem.com/uploads/structure/2214207-73-3.png)
Catalog Number: L004074
CAS Number: 2214207-73-3
Molecular Formula: C22H28O2P2
Molecular Weight:386.4
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C22H28O2P2 |
|---|---|
| Molecular Weight | 386.4 |
| Purity | ≥95% |
Computed Descriptor
| IUPAC Name | (3R)-3-tert-butyl-4-[(3R)-3-tert-butyl-2H-1,3-benzoxaphosphol-4-yl]-2H-1,3-benzoxaphosphole |
|---|---|
| InChI | InChI=1S/C22H28O2P2/c1-21(2,3)25-13-23-17-11-7-9-15(19(17)25)16-10-8-12-18-20(16)26(14-24-18)22(4,5)6/h7-12H,13-14H2,1-6H3/t25-,26-/m0/s1 |
| InChIKey | CKHIWGYUNCCXKO-UIOOFZCWSA-N |
| SMILES | CC(C)(C)[P@]1COC2=CC=CC(=C21)C3=C4C(=CC=C3)OC[P@@]4C(C)(C)C |