For research use only. Not for therapeutic Use.
3PO (Cat No.:I002393) is a small molecule that has been studied for its potential applications in cancer therapy. It works by inhibiting certain enzymes involved in DNA repair mechanisms, particularly in the context of cancer cell survival. By targeting these pathways, 3PO can enhance the effects of radiation or chemotherapy, potentially making cancer cells more susceptible to treatment. Research into 3PO is ongoing, with an emphasis on its role in enhancing the efficacy of existing cancer therapies.
| CAS Number | 18550-98-6 |
| Synonyms | 3-(3-pyridinyl)-1-(4-pyridinyl)-2E-propen-1-one |
| Molecular Formula | C13H10N2O |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IC50 | 1.4-24 μM |
| IUPAC Name | (E)-3-pyridin-3-yl-1-pyridin-4-ylprop-2-en-1-one |
| InChI | InChI=1S/C13H10N2O/c16-13(12-5-8-14-9-6-12)4-3-11-2-1-7-15-10-11/h1-10H/b4-3+ |
| InChIKey | UOWGYMNWMDNSTL-ONEGZZNKSA-N |
| SMILES | C1=CC(=CN=C1)C=CC(=O)C2=CC=NC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |