For research use only. Not for therapeutic Use.
(3aR,4R,7S,7aS)-Hexahydro-4,7-methano-1H-isoindole-1,3(2H)-dione is a chiral bicyclic compound used in organic synthesis. It features a fused ring system with specific stereochemistry, making it valuable in developing pharmaceuticals and advanced materials. Its unique structure allows for the exploration of stereochemical effects in chemical reactions and the creation of complex, bioactive molecules.
| CAS Number | 1807983-67-0 |
| Synonyms | Hexahydro-1H-4,7-methanoisoindole-1,3(2H)-dione |
| Molecular Formula | C9H11NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| InChI | InChI=1S/C9H11NO2/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8/h4-7H,1-3H2,(H,10,11,12)/t4-,5+,6-,7+ |
| InChIKey | RIVOBMOBWMOLDJ-UMRXKNAASA-N |
| SMILES | C1CC2CC1C3C2C(=O)NC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |