3,8-Dibromophenanthroline (Cat No.:M001476) is a chemical compound with the molecular formula C12H6Br2N2. It is a derivative of phenanthroline, featuring bromine atoms substituted at positions 3 and 8 of the phenanthroline ring. This compound is used as a ligand in coordination chemistry, particularly in the synthesis of transition metal complexes for various applications, such as catalysis and molecular recognition. The presence of the dibromophenanthroline moiety enhances its binding properties to metal ions, making it valuable for creating selective and functional coordination compounds. 3,8-Dibromophenanthroline plays a crucial role in the design of novel materials for diverse scientific and industrial purposes.
Catalog Number | M001476 |
CAS Number | 100125-12-0 |
Molecular Formula | C12H6Br2N2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 3,8-dibromo-1,10-phenanthroline |
InChI | InChI=1S/C12H6Br2N2/c13-9-3-7-1-2-8-4-10(14)6-16-12(8)11(7)15-5-9/h1-6H |
InChIKey | IDWJREBUVYSPKS-UHFFFAOYSA-N |
SMILES | C1=CC2=CC(=CN=C2C3=NC=C(C=C31)Br)Br |