For research use only. Not for therapeutic Use.
3,6-Diethynylcarbazole(CAT: L026555) is a high-purity, multifunctional compound featuring a carbazole core substituted with ethynyl groups at positions 3 and 6. This unique structure makes it a valuable building block in material science, particularly for the development of organic semiconductors, light-emitting materials, and conductive polymers. Its conjugated system enhances electronic and optical properties, supporting applications in OLEDs, photovoltaic devices, and advanced nanomaterials. Known for its versatility and stability, 3,6-Diethynylcarbazole enables the creation of functionalized materials with tailored performance characteristics, making it essential for innovative research in both academic and industrial settings.
CAS Number | 909342-65-0 |
Molecular Formula | C16H9N |
Purity | ≥95% |
IUPAC Name | 3,6-diethynyl-9H-carbazole |
InChI | InChI=1S/C16H9N/c1-3-11-5-7-15-13(9-11)14-10-12(4-2)6-8-16(14)17-15/h1-2,5-10,17H |
InChIKey | JNLNYORJQOYKHH-UHFFFAOYSA-N |
SMILES | C#CC1=CC2=C(C=C1)NC3=C2C=C(C=C3)C#C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |