For research use only. Not for therapeutic Use.
3,6-Dichloropyrazine-2-carboxylic acid is a heterocyclic compound featuring a pyrazine ring with two chlorine substituents at the 3 and 6 positions and a carboxylic acid group at the 2-position. This unique arrangement enhances its reactivity and solubility, making it useful in organic synthesis and medicinal chemistry. The compound may serve as a building block for developing pharmaceuticals, agrochemicals, or other bioactive molecules. Its dichlorinated structure can influence biological activity and contribute to structure-activity relationship studies.
| CAS Number | 356783-15-8 |
| Molecular Formula | C5H2Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | 3,6-dichloropyrazine-2-carboxylic acid |
| InChI | InChI=1S/C5H2Cl2N2O2/c6-2-1-8-4(7)3(9-2)5(10)11/h1H,(H,10,11) |
| InChIKey | JKDYBIZSSBHQLV-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)Cl)C(=O)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |