For research use only. Not for therapeutic Use.
3,6-Dichloro-2-hydroxybenzoic acid (Cat No.: R035693) is a chlorinated derivative of salicylic acid, featuring hydroxyl and carboxylic acid groups ortho to each other, along with chlorine atoms at the 3- and 6-positions of the aromatic ring. This compound exhibits enhanced electron-withdrawing characteristics, making it useful in synthetic chemistry for designing more reactive intermediates. It serves as a building block in pharmaceuticals, agrochemicals, and dye chemistry. Its structural features support hydrogen bonding and reactivity modulation. Intended strictly for laboratory research and industrial applications.
CAS Number | 3401-80-7 |
Synonyms | 3,6-dichloro-(6CI,7CI,8CI) Salicylic Acid; 3,6-Dichloro-2-hydroxybenzoic Acid; 2-Hydroxy-3,6-dichlorobenzoic Acid; 3,6-DCSA; 3,6-Dichlorosalicylic Acid; |
Molecular Formula | C7H4Cl2O3 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 3,6-dichloro-2-hydroxybenzoic acid |
InChI | InChI=1S/C7H4Cl2O3/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,10H,(H,11,12) |
InChIKey | FKIKPQHMWFZFEB-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1Cl)C(=O)O)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |