3,6-Bis(5-bromothiophen-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione - CAS 777079-55-7

3,6-Bis(5-bromothiophen-2-yl)pyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione (Cat.No:L004342) is a crucial compound in materials science. Its distinctive structure, featuring bromothiophene units, imparts specialized electronic properties. This compound is utilized in the development of organic semiconductors for electronic devices. Its versatile reactivity and specific attributes make it an essential component in the quest for advanced materials, underscoring its significance in contemporary chemical research.

Catalog Number: L004342

CAS Number: 777079-55-7

Molecular Formula: C14H6Br2N2O2S2

Molecular Weight:458.2

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C14H6Br2N2O2S2
Molecular Weight458.2
Purity≥95%

Computed Descriptor

IUPAC Name1,4-bis(5-bromothiophen-2-yl)-3-hydroxy-2H-pyrrolo[3,4-c]pyrrol-6-one
InChIInChI=1S/C14H6Br2N2O2S2/c15-7-3-1-5(21-7)11-9-10(14(20)17-11)12(18-13(9)19)6-2-4-8(16)22-6/h1-4,17,20H
InChIKeySHWWUNDOIBEOIR-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)Br)C2=C3C(=C(N2)O)C(=NC3=O)C4=CC=C(S4)Br