For research use only. Not for therapeutic Use.
(3,5-Dimethoxyphenyl)acetonitrile is an aromatic compound known for its utility in organic synthesis and medicinal chemistry. Featuring two methoxy groups on the phenyl ring, this compound exhibits enhanced reactivity and solubility, making it suitable for various chemical reactions. It serves as an important intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Ongoing research explores its potential biological activities, including antimicrobial and anti-inflammatory properties, highlighting its relevance in drug discovery and the development of new therapeutic agents.
CAS Number | 13388-75-5 |
Synonyms | 3,5-Dimethoxy-benzeneacetonitrile; 3,5-Dimethoxybenzyl Cyanide; NSC 245126 |
Molecular Formula | C10H11NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3,5-dimethoxyphenyl)acetonitrile |
InChI | InChI=1S/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
InChIKey | UUNRWZQWCNTSCV-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1)CC#N)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |