For research use only. Not for therapeutic Use.
3,5-Difluoroisonicotinic acid is a fluorinated derivative of isonicotinic acid, widely used in pharmaceutical and chemical research. Its unique structure, with two fluorine atoms at the 3 and 5 positions on the pyridine ring, imparts distinct chemical properties, such as enhanced metabolic stability and increased binding affinity in drug molecules. This compound serves as a valuable intermediate in the synthesis of bioactive molecules, including potential anti-tuberculosis and anti-inflammatory agents. 3,5-Difluoroisonicotinic acid is particularly useful in medicinal chemistry for creating fluorinated analogs, aiding in the development of novel therapeutics and advanced materials.
| CAS Number | 903522-29-2 |
| Synonyms | 3,5-Difluoropyridine-4-carboxylic Acid; |
| Molecular Formula | C6H3F2NO2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 3,5-difluoropyridine-4-carboxylic acid |
| InChI | InChI=1S/C6H3F2NO2/c7-3-1-9-2-4(8)5(3)6(10)11/h1-2H,(H,10,11) |
| InChIKey | DRWDDFVJHGAJTN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)F)C(=O)O)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |