For research use only. Not for therapeutic Use.
3,5-Dichloro-4-methoxybenzaldehyde is an aromatic aldehyde characterized by dichloro substitutions at the 3 and 5 positions, along with a methoxy group at the 4-position of a benzene ring. This compound is valuable in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of both chlorine and methoxy groups enhances its reactivity and solubility, making it suitable for various chemical transformations. Its unique structure allows for further functionalization, facilitating the creation of bioactive compounds in medicinal chemistry.
| CAS Number | 41727-58-6 |
| Molecular Formula | C8H6Cl2O2 |
| Purity | ≥95% |
| IUPAC Name | 3,5-dichloro-4-methoxybenzaldehyde |
| InChI | InChI=1S/C8H6Cl2O2/c1-12-8-6(9)2-5(4-11)3-7(8)10/h2-4H,1H3 |
| InChIKey | LEEKELDJRCUBEM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)C=O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |