For research use only. Not for therapeutic Use.
3,5-Dichloro-2-nitrobenzoic acid(Cat No.:L006750). It contains a chlorinated benzene ring with a nitro group and a carboxylic acid group attached at the 2- and 5- positions, respectively. This compound is significant in organic synthesis, serving as a precursor for various pharmaceuticals, agrochemicals, and dyes. Its structure allows it to participate in diverse chemical reactions, making it valuable in the creation of complex molecules. Researchers use it as a key intermediate in the development of specialized chemicals, contributing to advancements in medicinal chemistry and materials science.
| CAS Number | 23082-45-3 |
| Molecular Formula | C7H3Cl2NO4 |
| Purity | ≥95% |
| IUPAC Name | 3,5-dichloro-2-nitrobenzoic acid |
| InChI | InChI=1S/C7H3Cl2NO4/c8-3-1-4(7(11)12)6(10(13)14)5(9)2-3/h1-2H,(H,11,12) |
| InChIKey | LKMJMYZOEGSMDN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)[N+](=O)[O-])Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |