For research use only. Not for therapeutic Use.
3,5-Dibromo-2,6-difluoropyridine (Cat.No:L004158) is a significant chemical compound with diverse applications. Its unique structure, featuring bromine and fluorine substituents on a pyridine ring, imparts specialized reactivity and properties. This compound is employed as a key intermediate in the synthesis of specialized materials and pharmaceuticals.
| CAS Number | 685517-84-4 |
| Molecular Formula | C5HBr2F2N |
| Purity | ≥95% |
| IUPAC Name | 3,5-dibromo-2,6-difluoropyridine |
| InChI | InChI=1S/C5HBr2F2N/c6-2-1-3(7)5(9)10-4(2)8/h1H |
| InChIKey | FGTBUWCNYCKCTK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Br)F)F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
