For research use only. Not for therapeutic Use.
3,5-Di-tert-butyl-4-hydroxybenzaldehyde(CAT: R063859) is an organic compound with aromatic properties. Its mode of action involves acting as an aldehyde derivative of 3,5-di-tert-butyl-4-hydroxybenzoic acid, commonly known as 3,5-di-tert-butylhydroxytoluene (BHT). This compound exhibits potent antioxidant properties, making it suitable for various applications in the food and cosmetic industries. As a food additive, it is utilized to prevent oxidation and extend the shelf life of products. In cosmetics, it is incorporated to protect against rancidity and maintain product stability.
CAS Number | 1620-98-0 |
Synonyms | 2,6-Di-tert-Butyl-4-formylphenol; 3,5-Bis(1,1-dimethylethyl)-4-hydroxybenzaldehyde; 4-Formyl-2,6-di-tert-butylphenol; 4-Hydroxy-3,5-di-tert-butylbenzaldehyde; NSC 14450 |
Molecular Formula | C15H22O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3,5-ditert-butyl-4-hydroxybenzaldehyde |
InChI | InChI=1S/C15H22O2/c1-14(2,3)11-7-10(9-16)8-12(13(11)17)15(4,5)6/h7-9,17H,1-6H3 |
InChIKey | DOZRDZLFLOODMB-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |