For research use only. Not for therapeutic Use.
3,5-Bis(trifluoromethyl)phenol(Cat No.:L047726)is an aromatic compound featuring two trifluoromethyl groups at the 3 and 5 positions on a phenol ring. This compound is widely used in pharmaceutical and chemical research due to its strong electron-withdrawing properties, which enhance the reactivity and stability of molecules. It serves as a valuable building block in synthesizing bioactive compounds, agrochemicals, and specialty chemicals. 3,5-Bis(trifluoromethyl)phenol is essential for researchers focused on developing new materials, drugs, and advanced organic compounds, offering versatility in various synthetic applications.
| CAS Number | 349-58-6 |
| Molecular Formula | C8H4F6O |
| Purity | ≥95% |
| IUPAC Name | 3,5-bis(trifluoromethyl)phenol |
| InChI | InChI=1S/C8H4F6O/c9-7(10,11)4-1-5(8(12,13)14)3-6(15)2-4/h1-3,15H |
| InChIKey | ODSXJQYJADZFJX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)O)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |