For research use only. Not for therapeutic Use.
3,5-Bis[(2-fluorophenyl)methylene]-4-piperidinone(Cat No.:R021410)is a synthetic compound known for its inhibitory activity in biological research, particularly within neurological studies. This molecule has been investigated for its potential to interact with ion channels or receptors involved in pain modulation and other neurological pathways. Its structure, featuring two fluorophenyl groups attached to a piperidinone core, provides it with unique chemical properties that enable selective interactions in pharmacological research. Researchers use this compound to explore mechanisms related to neurodegenerative diseases and as a tool in the development of novel therapeutic agents.
CAS Number | 342808-40-6 |
Molecular Formula | C19H16ClF2NO |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | -20°C |
IUPAC Name | (3E,5E)-3,5-bis[(2-fluorophenyl)methylidene]piperidin-4-one |
InChI | InChI=1S/C19H15F2NO/c20-17-7-3-1-5-13(17)9-15-11-22-12-16(19(15)23)10-14-6-2-4-8-18(14)21/h1-10,22H,11-12H2/b15-9+,16-10+ |
InChIKey | NIVYQYSNRUIFIF-KAVGSWPWSA-N |
SMILES | C\1NC/C(=C\C2=CC=CC=C2F)/C(=O)/C1=C/C3=CC=CC=C3F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |