For research use only. Not for therapeutic Use.
3′,4′,7-Trimethoxyquercetin（Cat No.:I044892）is a methylated flavonol derivative of quercetin, characterized by methoxy groups at the 3′, 4′, and 7 positions. Found in various medicinal plants, this compound retains the flavonoid core structure while exhibiting increased lipophilicity and metabolic stability due to methylation. It displays a range of pharmacological activities, including antioxidant, anti-inflammatory, anticancer, and neuroprotective effects. By modulating key signaling pathways such as NF-κB and PI3K/Akt, 3′,4′,7-trimethoxyquercetin contributes to cellular protection and immune regulation, making it a promising compound in therapeutic and nutraceutical development.
| CAS Number | 6068-80-0 |
| Synonyms | 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one |
| Molecular Formula | C18H16O7 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one |
| InChI | InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
| InChIKey | OEEUHNAUMMATJT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)OC)O)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
