Home
>
Reference Standards>Other Inhibitors> 3,4,5,6-TETRAHYDRO-2H-[1,4']BIPYRIDINYL-4-CARBOXYLIC ACID ETHYL ESTER
For research use only. Not for therapeutic Use.
3,4,5,6-Tetrahydro-2H-[1,4′]bipyridinyl-4-carboxylic acid ethyl ester (Cat No.:M021873) is a complex pyridine derivative with a tetrahydro-bipyridine ring system and an ethyl ester functional group. This compound likely serves as an intermediate in organic synthesis to create more intricate molecules for pharmaceutical and chemical research. Its specific chemical structure makes it an important building block with potential applications in the development of various compounds.
| CAS Number | 121912-29-6 |
| Molecular Formula | C13H18N2O2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | ethyl 1-pyridin-4-ylpiperidine-4-carboxylate |
| InChI | InChI=1S/C13H18N2O2/c1-2-17-13(16)11-5-9-15(10-6-11)12-3-7-14-8-4-12/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | GXLGGUQVDXBVGX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=CC=NC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |