For research use only. Not for therapeutic Use.
(3,4,5-Trimethoxybenzyl)hydrazine hydrochloride (Cat.No:L003685) is a vital chemical compound with diverse applications, particularly in pharmaceutical research. Its unique structure, incorporating three methoxy groups, confers specific reactivity and biological activity. This compound serves as a crucial building block in the synthesis of various pharmaceutical agents, underlining its significance in drug development processes.
CAS Number | 3903-97-7 |
Molecular Formula | C10H17ClN2O3 |
Purity | ≥95% |
IUPAC Name | (3,4,5-trimethoxyphenyl)methylhydrazine;hydrochloride |
InChI | InChI=1S/C10H16N2O3.ClH/c1-13-8-4-7(6-12-11)5-9(14-2)10(8)15-3;/h4-5,12H,6,11H2,1-3H3;1H |
InChIKey | QAORZEPQFPZUGD-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1OC)OC)CNN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |