For research use only. Not for therapeutic Use.
3,4,5-Trimethoxybenzylamine (Cat.No:M085473) is a chemical compound with three methoxy groups attached to a benzene ring, along with an amine functional group. It is used in organic synthesis as a building block for various pharmaceutical and agrochemical compounds, and is also employed in research and chemical manufacturing processes.
| CAS Number | 18638-99-8 |
| Molecular Formula | C10H15NO3 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | (3,4,5-trimethoxyphenyl)methanamine |
| InChI | InChI=1S/C10H15NO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,6,11H2,1-3H3 |
| InChIKey | YUPUSBMJCFBHAP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)CN |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |