For research use only. Not for therapeutic Use.
3,4-Ethylenedioxythiophene(Cat No.:M110023), commonly abbreviated as EDOT, is an organic compound used primarily in the synthesis of conductive polymers. It serves as a monomer for producing poly(3,4-ethylenedioxythiophene), widely known as PEDOT, which is celebrated for its excellent conductivity and stability. EDOT is a colorless liquid that integrates easily into polymer matrices, enhancing their electrical properties. Its applications span across various fields, including antistatic coatings, capacitors, and organic solar cells. EDOT’s effectiveness in polymer applications stems from its ability to form polymers that are both conductive and transparent, making it valuable in electronic and optoelectronic devices.
| CAS Number | 126213-50-1 |
| Molecular Formula | C6H6O2S |
| Purity | ≥95% |
| Storage | Desiccate at +4C |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine |
| InChI | InChI=1S/C6H6O2S/c1-2-8-6-4-9-3-5(6)7-1/h3-4H,1-2H2 |
| InChIKey | GKWLILHTTGWKLQ-UHFFFAOYSA-N |
| SMILES | C1COC2=CSC=C2O1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |