For research use only. Not for therapeutic Use.
3,4′-Dimethyl-[1,1′-biphenyl]-4-amine(CAT: L000198) is a crucial compound with versatile applications in organic chemistry. It serves as a valuable building block for the synthesis of various organic molecules, particularly in the field of material chemistry. This compound is instrumental in creating advanced materials, including liquid crystals, which have widespread applications in display technologies, such as LCD screens.
CAS Number | 116668-37-2 |
Molecular Formula | C14H15N |
Purity | ≥95% |
IUPAC Name | 2-methyl-4-(4-methylphenyl)aniline |
InChI | InChI=1S/C14H15N/c1-10-3-5-12(6-4-10)13-7-8-14(15)11(2)9-13/h3-9H,15H2,1-2H3 |
InChIKey | RHFXTYPJXCHYIG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |