For research use only. Not for therapeutic Use.
3,4-Dimethoxybenzonitrile（Cat No.:R070008）is an aromatic organic compound with the molecular formula C9H9NO2, featuring methoxy groups at the 3 and 4 positions of the benzene ring and a nitrile (-CN) group at the 1-position. It appears as a white to off-white crystalline solid and serves as a versatile intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. The electron-donating methoxy groups influence the reactivity of the nitrile group, facilitating further chemical modifications. It is also used in research focused on developing bioactive molecules, particularly those targeting neurological and cardiovascular conditions.
| CAS Number | 2024-83-1 |
| Molecular Formula | C9H9NO2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 3,4-dimethoxybenzonitrile |
| InChI | InChI=1S/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| InChIKey | OSEQIDSFSBWXRE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C#N)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
