For research use only. Not for therapeutic Use.
3,4-Dihydroxypyridine(CAT: M120942) is a pyridine derivative featuring hydroxyl groups at the 3 and 4 positions, making it a versatile compound in pharmaceutical, biochemical, and organic chemistry research. Its structure offers unique reactivity, particularly for applications in the synthesis of bioactive molecules, coordination complexes, and specialty chemicals. 3,4-Dihydroxypyridine is often employed in studies involving enzymatic activity, redox chemistry, and as a building block in drug discovery. With high purity and reliability, this compound supports advanced research in medicinal chemistry, synthetic methodologies, and the development of novel therapeutic agents.
CAS Number | 10182-48-6 |
Molecular Formula | C5H5NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-hydroxy-1H-pyridin-4-one |
InChI | InChI=1S/C5H5NO2/c7-4-1-2-6-3-5(4)8/h1-3,8H,(H,6,7) |
InChIKey | ZCUUVWCJGRQCMZ-UHFFFAOYSA-N |
SMILES | C1=CNC=C(C1=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |