For research use only. Not for therapeutic Use.
3,4-Dihydroxyacetophenone (Cat.No:M048059) is a phenolic compound with two hydroxyl groups attached to a benzene ring. It occurs naturally in various plants and has antioxidant properties. This compound is used in the synthesis of pharmaceuticals, as a flavoring agent, and in the preparation of organic compounds for research and industry.
| CAS Number | 1197-09-7 |
| Molecular Formula | C8H8O3 |
| Purity | ≥95% |
| Target | Tyrosinase |
| Storage | Desiccate at +4C |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)ethanone |
| InChI | InChI=1S/C8H8O3/c1-5(9)6-2-3-7(10)8(11)4-6/h2-4,10-11H,1H3 |
| InChIKey | UCQUAMAQHHEXGD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |