For research use only. Not for therapeutic Use.
3,4-Dihydro-1H-2-benzopyran-1-one(Cat No.:L043521)is a cyclic organic compound, also known as coumarinol, part of the benzopyran family. It serves as a fundamental scaffold in medicinal chemistry for synthesizing various pharmacologically active agents. This lactone is renowned for its potential antioxidant, anti-inflammatory, and anticoagulant properties, making it a valuable compound in developing new therapeutics. Its structure allows for diverse chemical modifications, which can enhance biological activity and solubility. 3,4-Dihydro-1H-2-benzopyran-1-one is crucial in drug discovery, particularly for creating treatments targeting cardiovascular diseases and disorders related to oxidative stress.
| CAS Number | 4702-34-5 |
| Molecular Formula | C9H8O2 |
| Purity | ≥95% |
| IUPAC Name | 3,4-dihydroisochromen-1-one |
| InChI | InChI=1S/C9H8O2/c10-9-8-4-2-1-3-7(8)5-6-11-9/h1-4H,5-6H2 |
| InChIKey | XVTAQSGZOGYIEY-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=CC=CC=C21 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |